CAS 4445-09-4
:octadecylboronic acid
Description:
Octadecylboronic acid is an organic compound characterized by its long hydrophobic alkyl chain and a boronic acid functional group. It typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic nature. The presence of the boronic acid group allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis, materials science, and as a ligand in coordination chemistry. Its long alkyl chain contributes to its surfactant properties, enabling it to interact with both organic and aqueous phases. Octadecylboronic acid is often utilized in the development of sensors, drug delivery systems, and in the modification of surfaces for enhanced biocompatibility. Additionally, it can participate in cross-linking reactions, which are valuable in creating polymeric materials with specific properties. Overall, octadecylboronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C18H39BO2
InChI:InChI=1/C18H39BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h20-21H,2-18H2,1H3
SMILES:CCCCCCCCCCCCCCCCCCB(O)O
Synonyms:- n-Octadecyldihydroxyborane
- 1-Octadecaneboronic acid (6CI,7CI,8CI)
- 1-stearylboronic acid
- Dihydroxyoctadecylborane
- Octadecylboranic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Octadecylboronic acid
CAS:Octadecylboronic acid is a trifluoromethyl-substituted boronate ester that has optical, thermal, and luminescent properties. It is also used as a sealant with polyvinyl chloride. The octadecylboronic acid molecule has an alkylthio group in the form of a methyl group and an alkynyl group in the form of a propargyl group. This compound's ring structure consists of alternating single and double bonds. Octadecylboronic acid is orally active at relatively low doses. It can be absorbed through the gut wall and metabolized into octadecenoic acid and octadecanoic acid, which are fatty acids. Octadecylboronic acid is also an organometallic compound that can react with other organic molecules to form complexes such as octaethylporphyrin (OEP) or octaethylmethanetetrayne (OEMT).Formula:C18H39BO2Purity:80%Color and Shape:PowderMolecular weight:298.32 g/mol



