CAS 4445-34-5
:Dibenz[c,e]oxepin-5(7H)-one
Description:
Dibenz[c,e]oxepin-5(7H)-one, with the CAS number 4445-34-5, is a polycyclic aromatic compound characterized by its unique structure, which includes a dibenzodioxepin framework. This compound features a fused ring system that contributes to its stability and potential reactivity. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the carbonyl group in the oxepin structure imparts certain chemical reactivity, making it a candidate for various chemical transformations. Dibenz[c,e]oxepin-5(7H)-one has garnered interest in medicinal chemistry, particularly for its potential pharmacological properties, including antipsychotic and antidepressant effects. Its structural characteristics may also influence its interactions with biological targets, making it a subject of study in drug development. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks if ingested or inhaled. Overall, dibenz[c,e]oxepin-5(7H)-one represents a fascinating compound within the realm of organic and medicinal chemistry.
Formula:C14H10O2
InChI:InChI=1S/C14H10O2/c15-14-13-8-4-3-7-12(13)11-6-2-1-5-10(11)9-16-14/h1-8H,9H2
InChI key:InChIKey=UYCIYTZGOBZBME-UHFFFAOYSA-N
SMILES:O=C1C=2C(C=3C(CO1)=CC=CC3)=CC=CC2
Synonyms:- 2-Biphenylcarboxylic acid, 2′-(hydroxymethyl)-, ε-lactone
- 2-Biphenylcarboxylicacid, 2'-(hydroxymethyl)-, e-lactone (7CI)
- Diphenide
- Dibenzo[c,e]oxepin-5(7H)-one
- Dibenz[c,e]oxepin-5(7H)-one
- Dibenz(c,e)oxepine-5(7H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
