CAS 4445-43-6

3-aminobiphenyl-4-carboxylic acid

Description:

3-Aminobiphenyl-4-carboxylic acid, with the CAS number 4445-43-6, is an organic compound characterized by its biphenyl structure, which consists of two connected aromatic rings. The presence of an amino group (-NH2) at the 3-position and a carboxylic acid group (-COOH) at the 4-position contributes to its chemical reactivity and solubility properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. It can participate in various chemical reactions, including amine and acid-based reactions, making it useful in organic synthesis and potentially in the development of pharmaceuticals or dyes. Additionally, the compound's structure suggests it may have biological activity, although specific applications would depend on further research. Safety data should be consulted, as compounds with amino and carboxylic acid groups can have specific handling and toxicity considerations.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1/C13H11NO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8H,14H2,(H,15,16)

SMILES: c1ccc(cc1)c1ccc(c(c1)N)C(=O)O

Synonyms:

• [1,1'-Biphenyl]-4-Carboxylic Acid, 3-Amino-
• 3-Aminobiphenyl-4-carboxylic acid

3-AMINO-1,1'-BIPHENYL-4-CARBOXYLICACID

CAS: 4445-43-6

Formula: C₁₃H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 213.2319

Ref: IN-DA00D8WK

3-Amino-[1,1'-biphenyl]-4-carboxylic acid

CAS: 4445-43-6

3-Amino-[1,1'-biphenyl]-4-carboxylic acid

Purity: 98%

Molecular weight: 213.23g/mol

Ref: 54-OR94688

3-Amino-1,1′-biphenyl-4-carboxylic acid

CAS: 4445-43-6

Formula: C₁₃H₁₁NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 213.236

Ref: 10-F066584