CymitQuimica logo

CAS 444577-70-2

:

4-methyl-3-oxo-2-(2-oxo-1,2-diphenyl-ethyl)-N-phenyl-pentanamide

Description:
4-Methyl-3-oxo-2-(2-oxo-1,2-diphenyl-ethyl)-N-phenyl-pentanamide, with the CAS number 444577-70-2, is a synthetic organic compound characterized by its complex structure, which includes a pentanamide backbone, ketone functional groups, and multiple aromatic rings. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential stability under standard conditions. The presence of the ketone groups suggests it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the aromatic rings contribute to its potential for π-π stacking interactions, which can influence its physical properties and reactivity. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values. Overall, this compound's unique structure positions it as a potentially valuable entity in organic synthesis and medicinal chemistry.
Formula:C26H25NO3
InChI:InChI=1/C26H25NO3/c1-18(2)24(28)23(26(30)27-21-16-10-5-11-17-21)22(19-12-6-3-7-13-19)25(29)20-14-8-4-9-15-20/h3-18,22-23H,1-2H3,(H,27,30)
SMILES:CC(C)C(=O)C(C(c1ccccc1)C(=O)c1ccccc1)C(=Nc1ccccc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.