CymitQuimica logo

CAS 444666-39-1

:

2-Chloro-5-fluorobenzeneboronic acid

Description:
2-Chloro-5-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and halogen substituents on a benzene ring. Its molecular structure features a chlorine atom at the 2-position and a fluorine atom at the 5-position of the aromatic ring, which influences its reactivity and solubility. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the synthesis of biaryl compounds. The boronic acid group allows for the formation of stable complexes with diols and is crucial in applications such as drug discovery and material science. Additionally, the presence of halogens can enhance its reactivity and selectivity in organic synthesis. As with many boronic acids, it is important to handle this compound with care, as it may be sensitive to moisture and air, which can affect its stability and reactivity.
Formula:C6H5BClFO2
InChI:InChI=1/C6H5BClFO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,10-11H
InChI key:OVTZJDSREVDCTJ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)B(O)O)Cl
Synonyms:
  • (2-Chloro-5-fluorophenyl)boronic acid
  • Boronic acid, B-(2-chloro-5-fluorophenyl)-
  • 2-Chloro-5-fluorophenylboronic acid
Found 5 products.