CAS 444666-41-5
:1-(4-methoxypyridin-2-yl)piperazine
Description:
1-(4-Methoxypyridin-2-yl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a 4-methoxypyridine substituent, indicating the presence of a pyridine ring with a methoxy group attached at the para position relative to the nitrogen atom. This structure contributes to its potential biological activity, as both piperazine and pyridine derivatives are known for their pharmacological properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the methoxy group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various neurological and psychiatric conditions. Additionally, the presence of the methoxy group can influence the compound's lipophilicity and overall reactivity, making it a subject of interest in synthetic organic chemistry and drug design.
Formula:C10H15N3O
InChI:InChI=1/C10H15N3O/c1-14-9-2-3-12-10(8-9)13-6-4-11-5-7-13/h2-3,8,11H,4-7H2,1H3
SMILES:COc1ccnc(c1)N1CCNCC1
Synonyms:- Piperazine, 1-(4-Methoxy-2-Pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
