CAS 4447-60-3
:2,2′,2′′-[Methylidynetris(oxy)]tris[propane]
Description:
2,2′,2′′-[Methylidynetris(oxy)]tris[propane], with CAS number 4447-60-3, is a chemical compound characterized by its structure, which includes multiple ether linkages and a central methylidynetris unit. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and conditions. It exhibits properties such as low volatility and moderate solubility in polar solvents, making it useful in various applications, including as a surfactant or in formulations requiring emulsification. The presence of multiple ether groups contributes to its hydrophilic characteristics, while the propane units provide hydrophobic properties, allowing for versatile interactions with different substances. Additionally, it may have applications in the fields of polymer chemistry and materials science due to its ability to modify surface properties and enhance stability. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H22O3
InChI:InChI=1S/C10H22O3/c1-7(2)11-10(12-8(3)4)13-9(5)6/h7-10H,1-6H3
InChI key:InChIKey=FPIVAWNGRDHRSQ-UHFFFAOYSA-N
SMILES:C(OC(C)C)(OC(C)C)OC(C)C
Synonyms:- 2,2',2''-[Methylidynetris(Oxy)]Trispropane
- 2,2′,2′′-[Methylidynetris(oxy)]tris[propane]
- 2,2′,2′′-[Methylidyntris(Oxy)]Trispropan
- 2-Diisopropoxymethoxy-Propane
- 2-[Bis(Propan-2-Yloxy)Methoxy]Propane
- 2-[Di(propan-2-yloxy)methoxy]propane
- Orthoformic Acid Triisopropyl Ester
- Propane, 2,2,2-methylidynetris(oxy)tris-
- Tipo
- Tri(2-propyl) orthoformate
- Tri(prop-2-yl) orthoformate
- Tri-iso-propyl orthoformate
- Triisopropoxymethane
- Triisopropyl Orthoformate Anhydrous &
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Triisopropyl Orthoformate
CAS:Formula:C10H22O3Purity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:190.28Triisopropyl Orthoformate
CAS:Formula:C10H22O3Purity:95%Color and Shape:LiquidMolecular weight:190.283Triisopropyl Orthoformate
CAS:Controlled ProductFormula:C9H12O4Color and Shape:NeatMolecular weight:184.189Triisopropyl Orthoformate
CAS:Triisopropyl orthoformate is a polycarboxylic acid with the chemical formula (CH)C(O)OC(CF) 3 . It is a colorless liquid that can be prepared by trimerization of propylene oxide. Triisopropyl orthoformate has been used to synthesize perfluorinated alkylthio compounds, amides, and functionalized molecules. It is a reactive compound that can undergo many reactions such as esterification, amidation, and oxidation. The asymmetric synthesis of triisopropyl orthoformate has been shown in the presence of a primary amino acid catalyst. Triisopropyl orthoformate is stable under normal conditions but decomposes when heated or exposed to strong oxidizing agents.Formula:C10H22O3Purity:Min. 95%Molecular weight:190.28 g/mol






