CymitQuimica logo

CAS 444728-11-4

:

(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetonitrile

Description:
The chemical substance known as (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetonitrile, with the CAS number 444728-11-4, is a compound that features a complex structure combining a chlorophenyl group with a thieno[3,2-c]pyridine moiety. This compound is characterized by its potential biological activity, which may include interactions with various biological targets, making it of interest in medicinal chemistry. The presence of the acetonitrile functional group suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. Additionally, the chlorophenyl group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. The thieno[3,2-c]pyridine structure contributes to its aromaticity and may play a role in its electronic properties. Overall, this compound's unique structural features may provide avenues for research in drug development, particularly in the context of targeting specific pathways or receptors in biological systems.
Formula:C15H13ClN2S
InChI:InChI=1/C15H13ClN2S/c16-13-4-2-1-3-12(13)14(9-17)18-7-5-15-11(10-18)6-8-19-15/h1-4,6,8,14H,5,7,10H2
SMILES:c1ccc(c(c1)C(C#N)N1CCc2c(ccs2)C1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.