CAS 444731-72-0
:2,3-Dimethyl-2H-indazol-6-amine
Description:
2,3-Dimethyl-2H-indazol-6-amine is a chemical compound characterized by its indazole core structure, which consists of a five-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 2 and 3 positions of the indazole ring contributes to its unique properties, including its potential solubility and reactivity. The amine functional group at the 6 position enhances its basicity and can participate in hydrogen bonding, making it a candidate for various chemical reactions and applications. This compound may exhibit biological activity, which has led to interest in its potential use in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing pathways in pharmacology. Additionally, the compound's stability and reactivity can be influenced by the presence of substituents on the indazole ring, making it a subject of study in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c1-6-8-4-3-7(10)5-9(8)11-12(6)2/h3-5H,10H2,1-2H3
InChI key:InChIKey=PVNVSSNARYHLRF-UHFFFAOYSA-N
SMILES:CC1=C2C(=NN1C)C=C(N)C=C2
Synonyms:- 2,3-Dimethyl-2H-indazol-6-ylamine
- 2,3-Dimethylindazol-6-amine
- 2,3-dimethyl-2H-indazol-6-amine
- 2H-indazol-6-amine, 2,3-dimethyl-
- 6-amino-2,3-dimethyl-2H-indazole
- 2,3-Dimethyl-6-amino-2H-indazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,3-Dimethyl-2H-indazol-6-amine
CAS:Formula:C9H11N3Purity:98%Color and Shape:SolidMolecular weight:161.20372,3-Dimethyl-2H-indazol-6-amine
CAS:2,3-Dimethyl-2H-indazol-6-aminePurity:≥95%Molecular weight:161.20g/mol2,3-Dimethyl-2H-indazol-6-amine
CAS:Formula:C9H11N3Purity:98%Color and Shape:SolidMolecular weight:161.2082,3-Dimethyl-2H-indazol-6-ylamine
CAS:Controlled ProductApplications 2,3-Dimethyl-2H-indazol-6-ylamine is a reagent used in the synthesis of Pazopanib derivatives as antitumor agents.
References Jia, Y., et al.: Chem. Biol. Drug Design, 83, 306 (2014)Formula:C9H11N3Color and Shape:NeatMolecular weight:161.22,3-Dimethyl-2H-indazol-6-amine
CAS:2,3-Dimethyl-2H-indazol-6-amine is a low energy chemical that has a high potential for environmental risk transfer. It is a synthetic compound and can be monitored using the endpoint detection technique. This compound reacts with tyrosine kinase to produce 2,3-dimethyl-2H-indazol-6(5H)-one. The reaction time of this process is about 20 minutes. Monitoring this process requires the integration of several techniques including monitoring for impurities, which are often present in low molecular weight compounds such as this one.Formula:C9H11N3Purity:Min. 95%Molecular weight:161.2 g/mol2,3-Dimethyl-2H-indazol-6-amine
CAS:2,3-Dimethyl-2H-indazol-6-amine is a useful organic compound for research related to life sciences. The catalog number is T66273 and the CAS number is 444731-72-0.Formula:C9H11N3Color and Shape:SolidMolecular weight:161.208







