CAS 4449-43-8
:A-thymidine
Description:
A-thymidine, also known as 2-deoxy-5-methyluridine, is a nucleoside that plays a crucial role in the structure of DNA. It is a derivative of thymidine, where the hydroxyl group at the 5-position of the uracil base is replaced by a methyl group. This modification contributes to its unique properties and biological functions. A-thymidine is characterized by its ability to participate in nucleic acid synthesis and is essential for DNA replication and repair processes. It is often utilized in molecular biology and biochemistry research, particularly in studies involving DNA synthesis and cellular metabolism. The compound is soluble in water and exhibits stability under physiological conditions, making it suitable for various laboratory applications. Additionally, its CAS number, 4449-43-8, serves as a unique identifier for regulatory and safety purposes. Overall, A-thymidine is an important molecule in the field of genetics and biochemistry, contributing to our understanding of nucleic acid structure and function.
Formula:C10H14N2O5
InChI:InChI=1/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8-/m0/s1
Synonyms:- 1-(2-Deoxy-alpha-D-ribofuranosyl)-5-methyluracil
- alpha-Thymidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
α-Thymidine
CAS:a-Thymidine is a thymidylate analog that is used as an anti-HIV drug. It is the L-enantiomer of thymidine, which is a nucleoside base in DNA. The biological effects of a-thymidine are due to its ability to be incorporated into DNA and act as a competitive inhibitor of the enzyme protein synthesis. It also has been shown to have antiviral properties against herpes simplex virus type 1 and hepatitis B virus.
Formula:C10H14N2O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:242.23 g/molRef: 3D-NT00283
Discontinued product

