CAS 444902-34-5

6-chloro-5-iodo-pyridin-3-ol

Description:

6-Chloro-5-iodo-pyridin-3-ol is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and iodine substituents at the 6 and 5 positions, respectively, contributes to its unique reactivity and potential applications in various chemical reactions. The hydroxyl group (-OH) at the 3 position enhances its polarity and solubility in polar solvents, making it useful in medicinal chemistry and as an intermediate in organic synthesis. This compound may exhibit biological activity due to the presence of halogen atoms, which can influence its interaction with biological targets. Additionally, the structural features of 6-chloro-5-iodo-pyridin-3-ol may allow for further derivatization, expanding its utility in the development of pharmaceuticals or agrochemicals. As with many halogenated compounds, considerations regarding its environmental impact and safety profile are essential in its handling and application.

Formula: C₅H₃ClINO

InChI: InChI=1/C5H3ClINO/c6-5-4(7)1-3(9)2-8-5/h1-2,9H

SMILES: c1c(cnc(c1I)Cl)O

Synonyms:

• 3-Pyridinol, 6-Chloro-5-Iodo-
• 6-Chloro-5-iodopyridin-3-ol

6-Chloro-5-iodopyridin-3-ol

CAS: 444902-34-5

Formula: C₅H₃ClINO

Molecular weight: 255.4409

Ref: IN-DA00DHW4

2-Chloro-3-iodo-5-hydroxypyridine

CAS: 444902-34-5

2-Chloro-3-iodo-5-hydroxypyridine

Purity: ≥95%

Molecular weight: 255.44g/mol

Ref: 54-OR345349