CAS 444907-56-6

methyl 5'-amino-2,3'-bithiophene-4'-carboxylate

Description:

Methyl 5'-amino-2,3'-bithiophene-4'-carboxylate is an organic compound characterized by its unique bithiophene structure, which consists of two thiophene rings connected by a carbon-carbon bond. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and solubility properties. The presence of the methyl ester group enhances its lipophilicity, making it suitable for various applications in organic synthesis and materials science. The bithiophene moiety is known for its electronic properties, which can be beneficial in organic electronics, such as organic photovoltaics and field-effect transistors. Additionally, the amino group can participate in hydrogen bonding and other interactions, potentially influencing the compound's behavior in biological systems or as a ligand in coordination chemistry. Overall, methyl 5'-amino-2,3'-bithiophene-4'-carboxylate exhibits a combination of structural features that make it a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₁₀H₉NO₂S₂

InChI: InChI=1/C10H9NO2S2/c1-13-10(12)8-6(5-15-9(8)11)7-3-2-4-14-7/h2-5H,11H2,1H3

SMILES: COC(=O)c1c(csc1N)c1cccs1

Synonyms:

• [2,3'-Bithiophene]-4'-Carboxylic Acid, 5'-Amino-, Methyl Ester

methyl 5′-amino-2,3′-bithiophene-4′-carboxylate

CAS: 444907-56-6

Formula: C₁₀H₉NO₂S₂

Purity: 95.0%

Molecular weight: 239.31

Ref: 10-F307627