CAS 444907-60-2
:1-methoxy-N-(4-nitrobenzyl)propan-2-amine
Description:
1-Methoxy-N-(4-nitrobenzyl)propan-2-amine, identified by its CAS number 444907-60-2, is a chemical compound that features a propan-2-amine backbone substituted with a methoxy group and a nitrobenzyl moiety. This compound is characterized by its amine functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the methoxy group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. The nitro group on the benzyl ring introduces electron-withdrawing characteristics, which can impact the compound's reactivity and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in various fields, including pharmaceuticals, where modifications to the amine or aromatic components could lead to derivatives with enhanced efficacy or selectivity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity associated with the nitro group.
Formula:C11H16N2O3
InChI:InChI=1/C11H16N2O3/c1-9(8-16-2)12-7-10-3-5-11(6-4-10)13(14)15/h3-6,9,12H,7-8H2,1-2H3
SMILES:CC(COC)NCc1ccc(cc1)N(=O)=O
Synonyms:- benzenemethanamine, N-(2-methoxy-1-methylethyl)-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.