CAS 444915-77-9

4-(Difluoromethyl)benzenemethanol

Description:

4-(Difluoromethyl)benzenemethanol, with the CAS number 444915-77-9, is an organic compound characterized by the presence of a difluoromethyl group attached to a benzene ring, which is further connected to a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic compounds and alcohols. The difluoromethyl group introduces significant electronegativity, influencing the compound's reactivity and polarity. As a result, 4-(Difluoromethyl)benzenemethanol may demonstrate unique solubility characteristics, potentially being soluble in polar solvents while exhibiting limited solubility in nonpolar solvents. The presence of the hydroxymethyl group allows for hydrogen bonding, which can enhance its boiling point and melting point compared to similar compounds lacking this functional group. Additionally, this compound may serve as an intermediate in organic synthesis or as a building block in the development of pharmaceuticals and agrochemicals, owing to its functional groups that can participate in various chemical reactions. Overall, its unique structure and functional groups contribute to its potential applications in chemical research and industry.

Formula: C₈H₈F₂O

InChI: InChI=1S/C8H8F2O/c9-8(10)7-3-1-6(5-11)2-4-7/h1-4,8,11H,5H2

InChI key: InChIKey=YDYFWZBWPUDNAQ-UHFFFAOYSA-N

SMILES: C(F)(F)C1=CC=C(CO)C=C1

Synonyms:

• [4-(Difluoromethyl)phenyl]methanol
• 4-(Difluoromethyl)benzenemethanol
• Benzenemethanol, 4-(difluoromethyl)-

4-(Difluoromethyl)benzyl alcohol

CAS: 444915-77-9

4-(Difluoromethyl)benzyl alcohol

Formula: C₈H₈F₂O

Purity: ≥95%

Color and Shape: white. lumpy powder

Molecular weight: 158.15g/mol

Ref: 54-PC48346

4-(Difluoromethyl)benzyl alcohol

CAS: 444915-77-9

4-(Difluoromethyl)benzyl alcohol is a chemical intermediate with CAS No. 444915-77-9. It is a versatile building block that can be used to synthesize a wide variety of compounds, including useful scaffolds and speciality chemicals. 4-(Difluoromethyl)benzyl alcohol has been shown to be an effective reactant in the synthesis of complex compounds. It is also used as a reagent in high quality research and development laboratories.

Formula: C₈H₈F₂O

Purity: Min. 95%

Molecular weight: 158.15 g/mol

Ref: 3D-USA91577

[4-(difluoromethyl)phenyl]methanol

CAS: 444915-77-9

Purity: 98%

Molecular weight: 158.147995

Ref: 10-F718276