CAS 445-02-3: 4-Bromo-2-(trifluoromethyl)aniline
Description:4-Bromo-2-(trifluoromethyl)aniline is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to an aniline structure. Its molecular formula is C7H5BrF3N, indicating that it contains seven carbon atoms, five hydrogen atoms, one bromine atom, three fluorine atoms, and one nitrogen atom. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the aniline moiety. The trifluoromethyl group significantly influences its chemical reactivity and polarity, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of bromine enhances its electrophilic character, allowing for further substitution reactions. 4-Bromo-2-(trifluoromethyl)aniline is also of interest in materials science and organic synthesis due to its unique electronic properties. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental hazards.
Formula:C7H5BrF3N
InChI:InChI=1S/C7H5BrF3N/c8-4-1-2-6(12)5(3-4)7(9,10)11/h1-3H,12H2
InChI key:InChIKey=PHXGKHTWEOPCEW-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC(Br)=CC=C1N
- Synonyms:
- 2-(Trifluoromethyl)-4-bromoaniline
- 4-Bromo-2-(trifluoromethyl)aniline
- 4-Bromo-2-(trifluoromethyl)benzenamine
- 4-Bromo-2-trifluoromethylphenylamine
- 4-Bromo-alpha,alpha,alpha-trifluoro-o-toluidine
- Benzenamine, 4-bromo-2-(trifluoromethyl)-
- NSC 88311
- o-Toluidine, 4-bromo-α,α,α-trifluoro-
- 2-Amino-5-bromobenzotrifluoride

2-Amino-5-bromobenzotrifluoride
Ref: 3B-A1056
5g | 48.00 € | ||
25g | 144.00 € |

4-Bromo-2-(trifluoromethyl)aniline
Ref: IN-DA003GGM
5g | 25.00 € | ||
10g | 31.00 € | ||
25g | 42.00 € | ||
100g | 75.00 € | ||
500g | 205.00 € |

2-Amino-5-bromobenzotrifluoride
Ref: 54-PC1042
50g | 42.00 € | ||
100g | 65.00 € | ||
500g | 262.00 € |

2-Amino-5-bromobenzotrifluoride
Ref: 10-F001983
1g | 9.00 € | ||
10g | 14.00 € | ||
100g | 57.00 € | ||
500g | 213.00 € |

2-Amino-5-bromobenzotrifluoride
Ref: 3D-FA37783
1kg | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information | |
500g | Discontinued | Request information |