CAS 445-66-9
:4-Amino-3,5-dinitrobenzotrifluoride
Description:
4-Amino-3,5-dinitrobenzotrifluoride, with the CAS number 445-66-9, is an organic compound characterized by the presence of an amino group and two nitro groups attached to a benzene ring that is also substituted with a trifluoromethyl group. This compound typically appears as a yellow to orange solid and is known for its high stability and relatively low solubility in water, making it more soluble in organic solvents. The presence of the amino group imparts basic properties, while the nitro groups contribute to its potential as an explosive or propellant material due to their oxidizing characteristics. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. 4-Amino-3,5-dinitrobenzotrifluoride is primarily used in research and development, particularly in the fields of materials science and explosives, due to its unique chemical properties and potential applications in various chemical syntheses. Safety precautions are essential when handling this compound due to its hazardous nature.
Formula:C7H4F3N3O4
InChI:InChI=1/C7H4F3N3O4/c8-7(9,10)3-1-4(12(14)15)6(11)5(2-3)13(16)17/h1-2H,11H2
SMILES:c1c(cc(c(c1N(=O)=O)N)N(=O)=O)C(F)(F)F
Synonyms:- Benzenamine, 2,6-dinitro-4-(trifluoromethyl)-
- 2,6-Dinitro-4-(trifluoromethyl)benzenamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Dinitro-4-(trifluoromethyl)aniline
CAS:Formula:C7H4F3N3O4Purity:97%Color and Shape:SolidMolecular weight:251.11964-Amino-3,5-dinitrobenzotrifluoride
CAS:4-Amino-3,5-dinitrobenzotrifluoridePurity:97%Color and Shape:Yellow PowderMolecular weight:251.12g/mol4-Amino-3,5-dinitrobenzotrifluoride
CAS:Formula:C7H4F3N3O4Color and Shape:SolidMolecular weight:251.1212,6-Dinitro-4-(trifluoromethyl)aniline
CAS:2,6-Dinitro-4-(trifluoromethyl)aniline (2,6-DNTFA) is a chemical that is used for the selective control of horticultural weeds. 2,6-DNTFA is a nitrosamine that has been shown to be effective against a broad spectrum of weed species in horticultural crops. It is also used as an intermediate for the synthesis of other herbicides such as fluazinam. Although 2,6-DNTFA can be produced in two different polymorphic forms, only one form has been shown to be active against weeds. The selection of this polymorph requires optimization studies.
Formula:C7H4F3N3O4Purity:Min. 95%Color and Shape:PowderMolecular weight:251.12 g/molRef: 3D-AAA44566
Discontinued product



