CAS 445-82-9

5'-Fluoro-2'-methoxyacetophenone

Description:

5'-Fluoro-2'-methoxyacetophenone, with the CAS number 445-82-9, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methoxy group attached to an acetophenone backbone. This compound typically appears as a solid or crystalline substance and is known for its role in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's lipophilicity and metabolic stability, making it of interest in drug development. The methoxy group contributes to the compound's electronic properties, influencing its reactivity and interaction with biological targets. Additionally, 5'-Fluoro-2'-methoxyacetophenone may exhibit specific physical properties such as melting and boiling points, solubility in organic solvents, and potential applications in the synthesis of pharmaceuticals or agrochemicals. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines due to potential hazards associated with its use.

Formula: C₉H₉FO₂

InChI: InChI=1/C9H9FO2/c1-6(11)8-5-7(10)3-4-9(8)12-2/h3-5H,1-2H3

SMILES: CC(=O)c1cc(ccc1OC)F

Synonyms:

• 1-(5-Fluoro-2-methoxyphenyl)ethanone
• Ethanone, 1-(5-fluoro-2-methoxyphenyl)-

1-(5-Fluoro-2-methoxyphenyl)ethanone

CAS: 445-82-9

Formula: C₉H₉FO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 168.1650

Ref: IN-DA003MBF

5'-Fluoro-2'-methoxyacetophenone

CAS: 445-82-9

5'-Fluoro-2'-methoxyacetophenone

Purity: 97%

Molecular weight: 168.16g/mol

Ref: 54-PC9857

5′-Fluoro-2′-methoxyacetophenone

CAS: 445-82-9

Formula: C₉H₉FO₂

Purity: 97%

Color and Shape: Low Melting Solid

Molecular weight: 168.167

Ref: 10-F019293