CAS 4451-36-9

β-Acetochloro-D-glucose

Description:

β-Acetochloro-D-glucose, with the CAS number 4451-36-9, is a derivative of glucose characterized by the presence of an acetyl and a chloro group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and alcohol, which is common for many carbohydrate derivatives. The presence of the chloro group introduces unique reactivity, making it useful in various chemical syntheses and modifications. β-Acetochloro-D-glucose can participate in nucleophilic substitution reactions due to the electrophilic nature of the chloro group, allowing for further functionalization. Additionally, the acetyl group can influence the compound's reactivity and solubility, making it a valuable intermediate in organic synthesis and carbohydrate chemistry. Its structural features also suggest potential applications in the development of glycosylation reactions and as a building block for more complex carbohydrate derivatives. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential reactivity and toxicity.

Formula: C₁₃H₁₇ClO₁₀

InChI: InChI=1/C13H17ClO10/c1-5(15)20-4-8-9(21-6(2)16)10(22-7(3)17)11(12(14)23-8)24-13(18)19/h8-12H,4H2,1-3H3,(H,18,19)/t8?,9-,10?,11+,12-/m1/s1

Synonyms:

• b-D-Glucopyranosyl chloride,2,3,4,6-tetraacetate
• [(3R,5S,6S)-3-acetoxy-2-(acetoxymethyl)-5-carboxyoxy-6-chloro-tetrahydropyran-4-yl] acetate
• 2,3,4,6-Tetra-O-Acetyl-Beta-D-Glucopyranosyl Chloride

2,3,4,6-TETRA-O-ACETYL-β-D-GLUCOPYRANOSYL CHLORIDE

CAS: 4451-36-9

Formula: C₁₄H₁₉ClO₉

Purity: 97%

Color and Shape: Solid

Molecular weight: 366.7483

Ref: IN-DA00DCGY

(2R,3R,4S,5R,6S)-2-(Acetoxymethyl)-6-chlorotetrahydro-2H-pyran-3,4,5-triyl triacetate

CAS: 4451-36-9

(2R,3R,4S,5R,6S)-2-(Acetoxymethyl)-6-chlorotetrahydro-2H-pyran-3,4,5-triyl triacetate

Purity: 95%

Molecular weight: 366.75g/mol

Ref: 54-OR1051441

2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl chloride

CAS: 4451-36-9

2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl chloride is a fluorescent probe for nuclei and quadrupole resonance spectroscopy. It has been used to study the nuclear quadrupole resonance of anions in aqueous solution. The fluorescence intensity of 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl chloride is proportional to the concentration of anions in water. Fluorescence properties were evaluated by measuring the emission spectrum at various excitation wavelengths. The absorption spectrum was also measured to determine the fluorescence quantum yield and fluorescence lifetime.

Formula: C₁₄H₁₉ClO₉

Purity: Min. 95 Area-%

Color and Shape: White Off-White Powder

Molecular weight: 366.8 g/mol

Ref: 3D-MT02261