CAS 4452-06-6

1-(naphthalen-2-yl)prop-2-en-1-one

Description:

1-(Naphthalen-2-yl)prop-2-en-1-one, also known as 2-naphthyl propenone, is an organic compound characterized by its structure, which features a naphthalene ring attached to a propenone moiety. This compound typically appears as a yellow to orange solid and is known for its aromatic properties due to the presence of the naphthalene group. It has a conjugated double bond system, which contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of various derivatives through electrophilic substitution reactions. The compound is also noted for its potential use in the field of photochemistry and as a building block in the synthesis of more complex organic molecules. Its solubility varies depending on the solvent, and it may exhibit fluorescence under certain conditions. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 1-(naphthalen-2-yl)prop-2-en-1-one is a versatile compound with significant relevance in chemical research and applications.

Formula: C₁₃H₁₀O

InChI: InChI=1/C13H10O/c1-2-13(14)12-8-7-10-5-3-4-6-11(10)9-12/h2-9H,1H2

SMILES: C=CC(=O)c1ccc2ccccc2c1

Synonyms:

• 1-(2-Naphthyl)prop-2-en-1-one
• 2-Propen-1-one, 1-(2-naphthalenyl)-

ZM 449829

CAS: 4452-06-6

Formula: C₁₃H₁₀O

Purity: 97%

Molecular weight: 182.2179

Ref: IN-DA00DAQN

1-(Naphthalen-2-yl)prop-2-en-1-one

CAS: 4452-06-6

1-(Naphthalen-2-yl)prop-2-en-1-one

Purity: 97%

Molecular weight: 182.22g/mol

Ref: 54-OR1057855

ZM 449829

CAS: 4452-06-6

ZM 449829: Selective JAK3 inhibitor, binds to ATP site. pIC50: 6.8 for JAK3, others < 5.0.

Formula: C₁₃H₁₀O

Purity: 98%

Color and Shape: Solid

Molecular weight: 182.222

Ref: TM-T23564