CAS 445264-61-9: 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, identified by its CAS number 445264-61-9, is an organic compound that features a pyridine ring substituted with a methoxy group and a boron-containing moiety. The presence of the methoxy group enhances its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The tetramethyl-1,3,2-dioxaborolane unit contributes to its potential as a boron source in various chemical reactions, particularly in cross-coupling reactions, which are significant in organic synthesis and materials science. This compound may exhibit unique properties such as fluorescence or specific reactivity patterns due to the combination of the pyridine and boron functionalities. Its applications could extend to pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. As with many boron-containing compounds, it is essential to handle it with care, considering potential reactivity and toxicity.
Formula:C12H18BNO3
InChI:InChI=1S/C12H18BNO3/c1-11(2)12(3,4)17-13(16-11)9-6-7-10(15-5)14-8-9/h6-8H,1-5H3
InChI key:InChIKey=QOGNDJLSYMJGPP-UHFFFAOYSA-N
SMILES:N=1C=C(C=CC1OC)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- (2-Methoxypyridin-5-yl)boronic acid pinacol ester
- 2-(6-Methoxypyridin-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin
- 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- 2-Methoxy-5-pyridineboronic acid pinacol ester
- 2-Methoxyl-5-Pyridineboronic Acid Pinacol Ester
- 2-Methoxypyridine-5-boronic acid pinacol ester
- Pyridine, 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
