CymitQuimica logo

CAS 445295-04-5

:

Propanoic acid,2-[4-[[[[2-(1,3-benzodioxol-5-yloxy)-3-pyridinyl]carbonyl]amino]methyl]-3-fluorophenoxy]-, (2R)-

Description:
Propanoic acid, 2-[4-[[[[2-(1,3-benzodioxol-5-yloxy)-3-pyridinyl]carbonyl]amino]methyl]-3-fluorophenoxy]-, (2R)-, is a complex organic compound characterized by its unique structural features, including a propanoic acid moiety and multiple aromatic rings. The presence of a benzodioxole and a pyridine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound exhibits functional groups such as carboxylic acid, amine, and ether, which influence its solubility, reactivity, and interaction with biological targets. Its stereochemistry, indicated by the (2R) designation, suggests specific spatial arrangements that may affect its pharmacological properties. The fluorine substitution on the phenoxy group can enhance lipophilicity and metabolic stability. Overall, this compound's intricate structure and functional diversity suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways. Further studies would be necessary to elucidate its full chemical behavior and potential uses in various applications.
Formula:C23H19FN2O7
InChI:InChI=1S/C23H19FN2O7/c1-13(23(28)29)32-15-5-4-14(18(24)9-15)11-26-21(27)17-3-2-8-25-22(17)33-16-6-7-19-20(10-16)31-12-30-19/h2-10,13H,11-12H2,1H3,(H,26,27)(H,28,29)/t13-/m1/s1
InChI key:CNIGFESSDPOCKS-CYBMUJFWSA-N
SMILES:C[C@H](C(=O)O)OC1=CC(=C(C=C1)CNC(=O)C2=C(N=CC=C2)OC3=CC4=C(C=C3)OCO4)F
Found 6 products.