CymitQuimica logo

CAS 4453-90-1

:

1,4-Dihydro-1,4-methanonaphthalene

Description:
1,4-Dihydro-1,4-methanonaphthalene, also known as bicyclo[4.4.0]decane, is an organic compound characterized by its bicyclic structure, which consists of a naphthalene framework with two hydrogen atoms added to the double bonds, resulting in a saturated compound. This substance is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It has a relatively low boiling point and is insoluble in water but soluble in organic solvents. The compound exhibits interesting chemical reactivity due to the presence of its bicyclic structure, making it a subject of study in organic synthesis and materials science. Its unique structure allows for potential applications in the development of polymers and other materials. Additionally, 1,4-Dihydro-1,4-methanonaphthalene can serve as a precursor in various chemical reactions, including hydrogenation and cycloaddition processes. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential health hazards upon exposure.
Formula:C11H10
InChI:InChI=1S/C11H10/c1-2-4-11-9-6-5-8(7-9)10(11)3-1/h1-6,8-9H,7H2
InChI key:InChIKey=IEGYXSAHRKJELM-UHFFFAOYSA-N
SMILES:C1=2C(C3CC1C=C3)=CC=CC2
Synonyms:
  • 1,4-Methanonaphthalene, 1,4-dihydro-
  • 1,4-Dihydro-1,4-methanonaphthalene
  • Benzonorbornadiene
  • NSC 120540
Found 6 products.