CymitQuimica logo

CAS 445373-09-1

:

pyridine, 2-iodo-3,5-dimethyl-

Description:
2-Iodo-3,5-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with iodine and two methyl groups. The presence of the iodine atom introduces notable reactivity, particularly in nucleophilic substitution reactions, while the methyl groups enhance the compound's lipophilicity and influence its electronic properties. This compound typically exhibits a pale yellow to brownish color and has a distinct aromatic odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the pyridine ring and the methyl substituents. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Additionally, its structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. Safety precautions should be observed when handling this compound, as halogenated organic compounds can pose health risks.
Formula:C7H8IN
InChI:InChI=1/C7H8IN/c1-5-3-6(2)7(8)9-4-5/h3-4H,1-2H3
SMILES:Cc1cc(C)c(I)nc1
Synonyms:
  • 2-Iodo-3,5-dimethylpyridine
  • Pyridine, 2-iodo-3,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.