CAS 4454-63-1
:2-chloro-N-(1,3,4-thiadiazol-2-yl)acetamide
Description:
2-Chloro-N-(1,3,4-thiadiazol-2-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and a thiadiazole moiety. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. It exhibits biological activity, making it of interest in pharmaceutical research, particularly for its potential antimicrobial and antifungal properties. The presence of the thiadiazole ring contributes to its reactivity and interaction with biological targets. Additionally, the chloro substituent can enhance its electrophilic character, influencing its reactivity in various chemical reactions. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-chloro-N-(1,3,4-thiadiazol-2-yl)acetamide is a compound of interest in both synthetic chemistry and medicinal applications, warranting further investigation into its properties and potential uses.
Formula:C4H4ClN3OS
InChI:InChI=1/C4H4ClN3OS/c5-1-3(9)7-4-8-6-2-10-4/h2H,1H2,(H,7,8,9)
SMILES:C(C(=Nc1nncs1)O)Cl
Synonyms:- Acetamide, 2-chloro-N-1,3,4-thiadiazol-2-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
