CAS 445473-58-5
:1-n-Butyl-3-methylimidazolium n-octylsulfate
Description:
1-n-Butyl-3-methylimidazolium n-octylsulfate is an ionic liquid characterized by its unique combination of a butyl and methyl-substituted imidazolium cation and an n-octyl sulfate anion. This compound typically exhibits low volatility and high thermal stability, making it suitable for various applications in green chemistry and as a solvent in chemical processes. Its ionic nature contributes to its ability to dissolve a wide range of organic and inorganic materials, enhancing its utility in extraction and separation processes. Additionally, this ionic liquid is known for its relatively low toxicity compared to traditional organic solvents, which aligns with the principles of sustainable chemistry. The presence of the long-chain n-octyl sulfate anion imparts surfactant-like properties, potentially allowing for the stabilization of emulsions and enhancing solubilization of hydrophobic compounds. Overall, 1-n-Butyl-3-methylimidazolium n-octylsulfate represents a versatile and environmentally friendly alternative to conventional solvents in various industrial and laboratory applications.
Formula:C16H32N2O4S
InChI:InChI=1/C8H15N2.C8H18O4S/c1-3-4-5-10-7-6-9(2)8-10;1-2-3-4-5-6-7-8-12-13(9,10)11/h6-8H,3-5H2,1-2H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1
Synonyms:- 1-Butyl-3-methylimidazolium octyl sulfate
- 1-butyl-3-methyl-1H-imidazol-3-ium octyl sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-n-Butyl-3-methylimidazolium n-octyl sulfate, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C16H32N2O4SPurity:99%Color and Shape:crystalline solid, clear as melt, Colourless to brown liquid and/or fused orMolecular weight:348.51-Butyl-3-methylimidazolium octylsulfate, 98% [BMIM] [OctSO₄]
CAS:<p>1-Butyl-3-methylimidazolium octylsulfate, 98% [BMIM] [OctSO4]</p>Formula:C8H15N2CH3(CH2)7OSO3Purity:98%Color and Shape:beige solidMolecular weight:348.511-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate
CAS:Formula:C16H32N2O4SPurity:97%Color and Shape:LiquidMolecular weight:348.50131-Butyl-3-Methylimidazolium Octylsulfate
CAS:<p>1-Butyl-3-Methylimidazolium Octylsulfate</p>Purity:99%Molecular weight:348.5g/mol




