CAS 445491-71-4
:3-bromo-5-(methylsulfonyl)pyridine
Description:
3-Bromo-5-(methylsulfonyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted at the 3-position with a bromine atom and at the 5-position with a methylsulfonyl group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity and potential applications in synthesis. The methylsulfonyl group contributes to its polar nature, influencing its solubility in various solvents and its interactions in chemical reactions. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in the development of pharmaceuticals. Its molecular structure allows for various chemical transformations, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-bromo-5-(methylsulfonyl)pyridine is a versatile compound with significant implications in research and industry.
Formula:C6H6BrNO2S
InChI:InChI=1/C6H6BrNO2S/c1-11(9,10)6-2-5(7)3-8-4-6/h2-4H,1H3
SMILES:CS(=O)(=O)c1cc(cnc1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-bromo-5-methanesulfonylpyridine
CAS:Formula:C6H6BrNO2SPurity:97%Color and Shape:SolidMolecular weight:236.08633-Bromo-5-(methylsulphonyl)pyridine
CAS:3-Bromo-5-(methylsulphonyl)pyridineFormula:C6H6BrNO2SPurity:95%Color and Shape: off white solidMolecular weight:236.09g/mol3-Bromo-5-(methylsulfonyl)pyridine
CAS:Formula:C6H6BrNO2SPurity:97%Color and Shape:No data available.Molecular weight:236.083-Bromo-5-(methylsulfonyl)pyridine
CAS:<p>3-Bromo-5-(methylsulfonyl)pyridine is a small-molecule inhibitor that targets collagen, an important component in the development of autoimmune disorders. 3-Bromo-5-(methylsulfonyl)pyridine selectively inhibits the inflammatory response by inhibiting collagen synthesis in vivo. This drug has been shown to be effective in animal models of autoimmune disorders such as arthritis. 3-Bromo-5-(methylsulfonyl)pyridine is taken orally and has not been tested for effectiveness on humans.</p>Formula:C6H6BrNO2SPurity:Min. 95%Molecular weight:236.09 g/mol



