CAS 445493-23-2

(4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-one

Description:

The chemical substance with the name "(4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-one" and CAS number "445493-23-2" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a bicyclic structure with hydroxyl and acetyloxy substituents, indicating potential biological activity, possibly as a natural product or a derivative thereof. The presence of multiple chiral centers suggests that it may exhibit stereospecific interactions in biological systems. Additionally, the compound contains an oxirane ring, which is known for its reactivity, particularly in nucleophilic addition reactions. Its structural complexity may contribute to unique properties, such as solubility and stability, influencing its potential applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the diversity of organic molecules and their potential roles in various chemical and biological processes.

Formula: C₃₀H₄₈O₈

InChI: InChI=1S/C30H48O8/c1-8-24(33)21(5)29-25(37-29)16-18(2)10-9-11-19(3)28-20(4)12-13-26(36-22(6)31)30(7,35)15-14-23(32)17-27(34)38-28/h9-13,18,20-21,23-26,28-29,32-33,35H,8,14-17H2,1-7H3/b10-9+,13-12+,19-11+/t18-,20+,21-,23-,24+,25-,26+,28-,29-,30-/m1/s1

InChI key: InChIKey=SDOUORKJIJYJNW-QHOUZYGJSA-N

SMILES: C([C@@H](/C=C/C=C(\C)/[C@@H]1[C@@H](C)/C=C/[C@H](OC(C)=O)[C@](C)(O)CC[C@@H](O)CC(=O)O1)C)[C@@H]2[C@@]([C@@H]([C@H](CC)O)C)(O2)[H]

Synonyms:

• Oxacyclododec-9-en-2-one, 8-(acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyl-, (4R,7R,8S,9E,11S,12S)-
• 11107B
• Oxacyclododec-9-en-2-one, 8-(acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]oxiranyl]-1,5-dimethyl-1,3-hexadienyl]-7,11-dimethyl-, (4R,7R,8S,9E,11S,12S)-
• (4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-one
• Pladienolide B

Pladienolide B

CAS: 445493-23-2

Formula: C₃₀H₄₈O₈

Molecular weight: 536.6973

Ref: IN-DA00DKMX

Pladienolide B

CAS: 445493-23-2

Pladienolide B, a macrolide from Streptomyces, inhibits spliceosome's SF3B1, causing necrosis and antitumor effects for leukemia and lymphoid studies.

Formula: C₃₀H₄₈O₈

Purity: 98.27% - 98.27%

Color and Shape: Solid

Molecular weight: 536.7

Ref: TM-T16551

Pladienolide B

CAS: 445493-23-2

Pladienolide B is a natural macrocyclic compound, which is a secondary metabolite derived from the culture broth of the bacterium Streptomyces platensis. It functions as a selective inhibitor of the spliceosome, a complex responsible for pre-mRNA splicing. By binding to the SF3b subunit of the spliceosome, Pladienolide B disrupts normal splicing processes, leading to alterations in gene expression. This disruption affects the growth and survival of cancer cells, demonstrating significant antitumor activity in various cancer models.Pladienolide B's unique mechanism of targeting the spliceosome makes it a subject of interest in cancer research, particularly for malignancies resistant to conventional therapies. Its efficacy in preclinical studies highlights its potential as a lead compound for the development of novel anticancer drugs. Researchers investigate its applications in targeting specific cancer types, exploring synergies with other treatments, and understanding resistance mechanisms, making it an important tool in both basic research and therapeutic exploration.

Formula: C₃₀H₄₈O₈

Molecular weight: 536.7 g/mol

Ref: 3D-FP184560