CAS 446-31-1
:4-Amino-2-fluorobenzoic acid
Description:
4-Amino-2-fluorobenzoic acid, also known as 4-amino-2-fluorobenzoate, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a benzoic acid structure. Its molecular formula is C7H6FNO2, and it features a carboxylic acid group (-COOH) that contributes to its acidic properties. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the fluorine atom can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. 4-Amino-2-fluorobenzoic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, it may exhibit biological activity, potentially serving as a building block for drug development or as a research tool in biochemical studies. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H6FNO2
InChI:InChI=1/C7H6FNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11)
SMILES:c1cc(c(cc1F)N)C(=O)O
Synonyms:- 2-Fluoro-4-aminobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
4-Amino-2-fluorobenzoic Acid
CAS:Formula:C7H6FNO2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:155.134-Amino-2-fluorobenzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6FNO2Purity:98%Color and Shape:Cream to pale yellow, PowderMolecular weight:155.134-Amino-2-fluorobenzoic acid
CAS:Formula:C7H6FNO2Purity:98%Color and Shape:SolidMolecular weight:155.12644-Amino-2-fluorobenzoic acid
CAS:Formula:C7H6FNO2Purity:≥ 98.0%Color and Shape:Light yellow or beige to dark orange crystalline powderMolecular weight:155.134-Amino-2-fluorobenzoic acid
CAS:4-Amino-2-fluorobenzoic acidFormula:C7H6FNO2Purity:98%Color and Shape: light brown to light yellow solidMolecular weight:155.13g/mol4-Amino-2-fluorobenzoic acid
CAS:4-Amino-2-fluorobenzoic acid is a potent inhibitor of formylating enzymes, such as carbonyl reductase and amino acid formyltransferase. It has been shown to be an effective inhibitor of cancer cells in vivo and inhibits the growth of prostate cancer cells. This compound has also been shown to inhibit nitro reduction reactions, which are involved in the carcinogenic process. 4-Amino-2-fluorobenzoic acid reacts with chloride ions to produce a functional group that can react with carbon nanotubes, making it a candidate for use in cancer therapy.Formula:C7H6FNO2Purity:Min. 95%Color and Shape:SolidMolecular weight:155.13 g/mol4-Amino-2-fluorobenzoic acid
CAS:Formula:C7H6FNO2Purity:98%Color and Shape:SolidMolecular weight:155.128








