CAS 446-37-7

4-(Dimethylamino)-3-fluorobenzenemethanol

Description:

4-(Dimethylamino)-3-fluorobenzenemethanol, with the CAS number 446-37-7, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a dimethylamino group attached to a benzene ring. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its potential applications in various fields, including pharmaceuticals and dye manufacturing, due to its ability to act as a dye precursor or an intermediate in organic synthesis. The presence of the dimethylamino group contributes to its basicity and solubility in polar solvents, while the fluorine atom can influence its reactivity and electronic properties. Additionally, this compound may exhibit specific optical properties, making it useful in applications involving fluorescence. Safety data should be consulted, as it may pose health risks if not handled properly, including potential toxicity or irritant effects. Overall, 4-(Dimethylamino)-3-fluorobenzenemethanol is a versatile compound with significant relevance in chemical research and industrial applications.

Formula: C₉H₁₂FNO

InChI: InChI=1S/C9H12FNO/c1-11(2)9-4-3-7(6-12)5-8(9)10/h3-5,12H,6H2,1-2H3

InChI key: InChIKey=IPYOLIXNVPEJJO-UHFFFAOYSA-N

SMILES: N(C)(C)C1=C(F)C=C(CO)C=C1

Synonyms:

• 4-(Dimethylamino)-3-fluorobenzenemethanol
• [4-(Dimethylamino)-3-fluorophenyl]methanol
• Benzyl alcohol, 4-(dimethylamino)-3-fluoro-
• Benzenemethanol, 4-(dimethylamino)-3-fluoro-

[4-(Dimethylamino)-3-fluorophenyl]methanol

CAS: 446-37-7

Versatile small molecule scaffold

Formula: C₉H₁₂FNO

Purity: Min. 95%

Molecular weight: 169.2 g/mol

Ref: 3D-AAA44637