CAS 446-38-8
:3-Fluoro-4-nitroanisole
Description:
3-Fluoro-4-nitroanisole, with the CAS number 446-38-8, is an organic compound characterized by the presence of both a fluorine atom and a nitro group attached to an anisole structure. This compound features a methoxy group (-OCH3) linked to a benzene ring, which is further substituted at the 3-position with a fluorine atom and at the 4-position with a nitro group (-NO2). The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like 3-fluoro-4-nitroanisole exhibit moderate polarity due to the electronegative fluorine and nitro groups, which can also enhance their reactivity in electrophilic aromatic substitution reactions. Additionally, this compound may be used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and potentially hazardous.
Formula:C7H6FNO3
InChI:InChI=1/C7H6FNO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3
SMILES:COc1ccc(c(c1)F)N(=O)=O
Synonyms:- 2-Fluoro-4-methoxynitrobenzene
- 2-Fluoro-4-Methoxy-1-Nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-4-methoxy-1-nitrobenzene
CAS:Formula:C7H6FNO3Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:171.133-Fluoro-4-nitroanisole
CAS:3-Fluoro-4-nitroanisoleFormula:C7H6FNO3Purity:98%Color and Shape: off-white crystalline solidMolecular weight:171.13g/mol3-Fluoro-4-nitroanisole
CAS:3-Fluoro-4-nitroanisole is a regiospecific synthesised compound that binds to albumin in the human serum. It has been shown to be an endogenous metabolite of 3-fluoro-4-nitrophenol, which is a potent inhibitor of cellular and blood assays for amines. The binding affinity for albumin was about 100 times higher than for other amines such as histamine or tyramine. 3-Fluoro-4-nitroanisole also has a high affinity for anions, with a pKb value of 8.7, which makes it suitable as an anion receptor in applications such as the determination of anion concentration in water samples. This fluoroquinonoid is also used as a fluorescent probe for nucleophilic reactions and can be used to detect nucleophiles in organic solvents by adding it to the reaction mixture.Formula:C7H6FNO3Purity:Min. 95%Color and Shape:Beige PowderMolecular weight:171.13 g/mol3-Fluoro-4-nitroanisole
CAS:Formula:C7H6FNO3Purity:95%Color and Shape:Solid, Grey powderMolecular weight:171.127




