CAS 446022-33-9
:Pelitrexol
Description:
Pelitrexol, identified by its CAS number 446022-33-9, is a chemical compound that belongs to the class of pharmaceuticals known as selective serotonin reuptake inhibitors (SSRIs). It is primarily investigated for its potential use in treating various mood disorders, including depression and anxiety. The compound exhibits a mechanism of action that involves the inhibition of serotonin reuptake in the brain, thereby increasing the availability of serotonin in the synaptic cleft, which can enhance mood and emotional well-being. Pelitrexol is characterized by its specific molecular structure, which contributes to its pharmacological properties. Additionally, it may have a favorable side effect profile compared to other SSRIs, although individual responses can vary. As with any pharmaceutical agent, its use should be guided by clinical evidence and under the supervision of a healthcare professional. Ongoing research may further elucidate its efficacy, safety, and potential applications in mental health treatment.
Formula:C20H25N5O6S
InChI:InChI=1/C20H25N5O6S/c1-9-6-14(18(29)23-12(19(30)31)3-5-15(26)27)32-13(9)4-2-10-7-11-16(22-8-10)24-20(21)25-17(11)28/h6,10,12H,2-5,7-8H2,1H3,(H,23,29)(H,26,27)(H,30,31)(H4,21,22,24,25,28)/t10-,12-/m0/s1
SMILES:Cc1cc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)sc1CC[C@H]1Cc2c(NC1)[nH]c(=N)nc2O
Synonyms:- N-((5-(2-((6S)-2-Amino-1,4,5,6,7,8-hexahydro-4-oxopyrido[2,3-d]pyrimidin-6-yl)ethyl)-4-methyl-2-thienyl)carbonyl)-L-glutamic acid
- N-[(5-{2-[(6S)-2-amino-4-oxo-1,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl]ethyl}-4-methylthiophen-2-yl)carbonyl]-L-glutamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pelitrexol
CAS:Pelitrexol is an antifolate chemotherapeutic agent, which is synthetically derived to target key enzymatic pathways in cancer cells. It functions predominantly through the inhibition of dihydrofolate reductase (DHFR), an enzyme critical for DNA synthesis and cell proliferation. By impeding the action of DHFR, Pelitrexol disrupts the folate cycle, leading to a depletion of tetrahydrofolate and subsequent impairment of nucleotide biosynthesis. This action results in the inhibition of tumor cell growth and proliferation, making Pelitrexol an effective cytotoxic agent.Formula:C20H25N5O6SPurity:Min. 95%Color and Shape:PowderMolecular weight:463.5 g/molPelitrexol
CAS:Pelitrexol (AG2037) is a GARFT inhibitor, which can inhibit the activity of mTORC1, block the cell cycle in the s-phase, with antiproliferative activity,NSCLC .Formula:C20H25N5O6SPurity:98.03%Color and Shape:SolidMolecular weight:463.51

