CAS 446044-44-6: (1R,2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)cyclohexanecarboxylic acid
Description:The chemical substance known as (1R,2R)-2-(1,3-dioxonaphtho[2,3-f]isoindol-2-yl)cyclohexanecarboxylic acid, with the CAS number 446044-44-6, is a complex organic compound characterized by its unique structural features. It contains a cyclohexanecarboxylic acid moiety, which contributes to its acidic properties, and a dioxonaphthoisoindole structure that may impart specific biological activities or interactions. The stereochemistry indicated by the (1R,2R) configuration suggests that the compound has specific spatial arrangements that can influence its reactivity and interactions with biological targets. This compound may exhibit properties such as solubility in organic solvents, potential for forming hydrogen bonds due to the presence of carboxylic acid functional groups, and possible applications in medicinal chemistry or materials science. Its intricate structure may also suggest potential for unique electronic or optical properties, making it of interest in various fields of research. Further studies would be necessary to elucidate its full range of characteristics and potential applications.
Formula:C23H19NO4
InChI:InChI=1/C23H19NO4/c25-21-18-11-15-9-13-5-1-2-6-14(13)10-16(15)12-19(18)22(26)24(21)20-8-4-3-7-17(20)23(27)28/h1-2,5-6,9-12,17,20H,3-4,7-8H2,(H,27,28)/t17-,20-/m1/s1