CAS 446065-20-9: 4-(3-Fluorophenyl)-2-thiazolamine

Description:4-(3-Fluorophenyl)-2-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's electronic properties and reactivity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The thiazole moiety is often associated with various biological activities, including antimicrobial and anticancer properties. The specific arrangement of functional groups in 4-(3-Fluorophenyl)-2-thiazolamine may also affect its interaction with biological targets, leading to diverse pharmacological effects. Additionally, the compound's stability, reactivity, and potential applications in drug development are influenced by its molecular structure. As with many thiazole derivatives, it may serve as a scaffold for further chemical modifications to enhance its therapeutic efficacy.

Formula:C₉H₇FN₂S

InChI:InChI=1S/C9H7FN2S/c10-7-3-1-2-6(4-7)8-5-13-9(11)12-8/h1-5H,(H2,11,12)

InChI key:InChIKey=XBHHILITQUEDDC-UHFFFAOYSA-N

SMILES:FC1=CC=CC(=C1)C=2N=C(SC2)N

Synonyms:
2-Amino-4-(3-fluorophenyl)thiazole
2-Thiazolamine, 4-(3-fluorophenyl)-
4-(3-Fluorophenyl)-2-thiazolamine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-(3-Fluoro-phenyl)-1,3-thiazol-2-amine REF: 10-F014089CAS: 446065-20-9	95.0%	98.00 €~1,431.00 €	Tue 08 Apr 25
4-(3-Fluoro-phenyl)-thiazol- 2-ylamine REF: IN-DA00DBH6CAS: 446065-20-9	98%	To inquire	Mon 14 Apr 25
2-Amino-4-(3-fluorophenyl)-1,3-thiazole REF: 54-PC5616CAS: 446065-20-9	- - -	97.00 €~172.00 €	Mon 21 Apr 25
4-(3-Fluorophenyl)-1,3-Thiazol-2-Amine REF: 3D-FF84514CAS: 446065-20-9	Min. 95%	- - -	Discontinued product