CAS 4461-15-8
:4-Amino-2,4-dihydro-5-(phenoxymethyl)-3H-1,2,4-triazole-3-thione
Description:
4-Amino-2,4-dihydro-5-(phenoxymethyl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a thione functional group, contributing to its reactivity and potential biological activity. The presence of the phenoxymethyl group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. Typically, compounds of this nature are investigated for their pharmacological properties, including antimicrobial and antifungal activities. The molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications in agricultural or pharmaceutical contexts are often explored in research. Safety and handling precautions are essential when working with such compounds, as they may exhibit toxicity or other hazardous properties.
Formula:C9H10N4OS
InChI:InChI=1S/C9H10N4OS/c10-13-8(11-12-9(13)15)6-14-7-4-2-1-3-5-7/h1-5H,6,10H2,(H,12,15)
InChI key:InChIKey=PKDBJOGLFPYJRY-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C=2N(N)C(=S)NN2
Synonyms:- 3H-1,2,4-Triazole-3-thione, 4-amino-2,4-dihydro-5-(phenoxymethyl)-
- 4-Amino-2,4-dihydro-5-(phenoxymethyl)-3H-1,2,4-triazole-3-thione
- 4-Amino-3-(phenoxymethyl)-5-mercapto-1,2,4-triazole
- 4-Amino-5-(phenoxymethyl)-4H-1,2,4-triazole-3-thiol
- 4H-1,2,4-Triazole-3-thiol, 4-amino-5-(phenoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
