CAS 4462-55-9
:3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride
Description:
3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride, with the CAS number 4462-55-9, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on the phenyl ring, which can significantly influence its reactivity and biological activity. The carbonyl chloride functional group suggests that it can act as an acylating agent, making it useful in various synthetic applications, particularly in the formation of amides or esters. The presence of the methyl group on the isoxazole ring may affect its solubility and stability. Overall, this compound is of interest in medicinal chemistry and material science, where its unique structural features can be leveraged for the development of pharmaceuticals or agrochemicals. Safety precautions should be observed when handling this compound due to its reactive nature, particularly the carbonyl chloride moiety, which can be corrosive and harmful.
Formula:C11H6Cl3NO2
InChI:InChI=1S/C11H6Cl3NO2/c1-5-8(11(14)16)10(15-17-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3
InChI key:InChIKey=IZQGELJKDARDMZ-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=CC=C1)C=2C(C(Cl)=O)=C(C)ON2
Synonyms:- 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
- 3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride
- 3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolylcarbonyl chloride
- 4-Isoxazolecarbonyl chloride, 3-(2,6-dichlorophenyl)-5-methyl-
- DCMIC Chloride
- 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonylchloride
CAS:Formula:C11H6Cl3NO2Purity:99%Color and Shape:SolidMolecular weight:290.52983-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl Chloride
CAS:Formula:C11H6Cl3NO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:290.523-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride
CAS:3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloridePurity:99%Color and Shape:Off-White SolidMolecular weight:290.52983g/molDcimc chloride
CAS:Dcimc chloride (3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride) has antibiotics activity.Formula:C11H6Cl3NO2Purity:97.2%Color and Shape:Off White Yellow To Brown Solid SolidMolecular weight:290.533-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride
CAS:Formula:C11H6Cl3NO2Purity:99%(GC-MS);RGColor and Shape:SolidMolecular weight:290.523-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride
CAS:<p>3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride is a chlorinated, thermosetting emulsifier that is used in the production of pressure sensitive adhesives. This compound has a high viscosity and is used as a retardant and an emulsifier. It is also used as a trichloride to produce vinyl chloride monomer. 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride inhibits the growth of bacteria by acting as an antimicrobial agent. The mechanism of action for this compound is not fully understood but it has been shown to inhibit protein synthesis in bacteria.</p>Formula:C11H6Cl3NO2Purity:Min. 95%Molecular weight:290.53 g/mol





