CAS 446251-73-6
:Methyl-2-deoxy-L-erythro-pentofuranose
Description:
Methyl-2-deoxy-L-erythro-pentofuranose is a carbohydrate derivative, specifically a methylated form of a pentose sugar. It is characterized by its five-carbon structure, which includes a furanose ring, a common feature in sugars that allows for various stereochemical configurations. The "2-deoxy" designation indicates that it lacks a hydroxyl group at the second carbon, which is significant for its biological activity and reactivity. This compound is typically involved in biochemical processes, particularly in the synthesis of nucleosides and nucleotides, which are essential for DNA and RNA structure. Its methylation at the anomeric carbon enhances its stability and solubility, making it useful in various synthetic applications in organic chemistry and biochemistry. Additionally, the L-configuration refers to the specific stereochemistry of the sugar, which can influence its interaction with enzymes and receptors in biological systems. Overall, Methyl-2-deoxy-L-erythro-pentofuranose serves as an important building block in the study of nucleic acids and related compounds.
Formula:C6H12O4
InChI:InChI=1/C6H12O4/c1-9-6-2-4(8)5(3-7)10-6/h4-8H,2-3H2,1H3/t4-,5+,6?/m1/s1
Synonyms:- Methyl-2-deoxy-L-erythro-pentofuranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2-deoxy-L-ribofuranoside
CAS:Methyl 2-deoxy-L-ribofuranoside is an intermediate in the synthesis of l-arabinose. It can be obtained by the reaction of methyl 2,3-dideoxy-D-ribofuranoside with pivaloyl chloride. The antiviral activity of this compound has been shown by its ability to inhibit the replication of influenza A virus. Methyl 2-deoxy-L-ribofuranoside is a fluorinating agent that can be used for the synthesis of oligosaccharides and nucleosides. This intermediate also serves as a substrate for a number of organic reactions, including regioselective and stereoselective chlorination.Formula:C6H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:148.16 g/mol


