CAS 446251-73-6: Methyl-2-deoxy-L-erythro-pentofuranose

Description:Methyl-2-deoxy-L-erythro-pentofuranose is a carbohydrate derivative, specifically a methylated form of a pentose sugar. It is characterized by its five-carbon structure, which includes a furanose ring, a common feature in sugars that allows for various stereochemical configurations. The "2-deoxy" designation indicates that it lacks a hydroxyl group at the second carbon, which is significant for its biological activity and reactivity. This compound is typically involved in biochemical processes, particularly in the synthesis of nucleosides and nucleotides, which are essential for DNA and RNA structure. Its methylation at the anomeric carbon enhances its stability and solubility, making it useful in various synthetic applications in organic chemistry and biochemistry. Additionally, the L-configuration refers to the specific stereochemistry of the sugar, which can influence its interaction with enzymes and receptors in biological systems. Overall, Methyl-2-deoxy-L-erythro-pentofuranose serves as an important building block in the study of nucleic acids and related compounds.

Formula:C₆H₁₂O₄

InChI:InChI=1/C6H12O4/c1-9-6-2-4(8)5(3-7)10-6/h4-8H,2-3H2,1H3/t4-,5+,6?/m1/s1

Synonyms:
Methyl-2-deoxy-L-erythro-pentofuranoside

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Methyl 2-deoxy-L-ribofuranoside REF: 7W-GC5881CAS: 446251-73-6	- - -	To inquire	Wed 16 Apr 25
Methyl 2-deoxy-L-erythro-pentofuranoside REF: 4Z-R-110016CAS: 446251-73-6	- - -	To inquire	Tue 22 Apr 25
Methyl 2-deoxy-L-ribofuranoside REF: 3D-MM02891CAS: 446251-73-6	Min. 95%	164.00 €~1,740.00 €	Tue 10 Jun 25