CymitQuimica logo

CAS 446273-59-2

:

3-Amino-4-bromo-6-chloropyridazine

Description:
3-Amino-4-bromo-6-chloropyridazine is a heterocyclic organic compound characterized by its pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of amino, bromo, and chloro substituents at specific positions on the ring contributes to its chemical reactivity and potential applications. The amino group (-NH2) typically enhances the compound's solubility in polar solvents and can participate in various chemical reactions, such as nucleophilic substitutions. The bromo (-Br) and chloro (-Cl) substituents are halogens that can serve as leaving groups in reactions or influence the compound's electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents and the amino group, making it a subject of study in synthetic organic chemistry.
Formula:C4H3BrClN3
InChI:InChI=1/C4H3BrClN3/c5-2-1-3(6)8-9-4(2)7/h1H,(H2,7,9)
InChI key:FGOWNGCSUSKHQI-UHFFFAOYSA-N
SMILES:c1c(c(=N)[nH]nc1Cl)Br
Synonyms:
  • 4-Bromo-6-chloro-3-pyridazinamine
  • 4-Bromo-6-chloropyridazin-3-amine
Found 5 products.