CymitQuimica logo

CAS 446276-15-9

:

3-(Cyclohexylmethylamino)-1,1,1-trifluoro-2-propanol

Description:
3-(Cyclohexylmethylamino)-1,1,1-trifluoro-2-propanol, with the CAS number 446276-15-9, is a chemical compound characterized by its unique structure that includes a trifluoromethyl group and a cyclohexylmethylamino moiety. This compound is likely to exhibit properties typical of alcohols, such as the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) group. The trifluoromethyl group can impart significant lipophilicity and influence the compound's reactivity and solubility in various solvents. Additionally, the cyclohexylmethylamino group may contribute to the compound's biological activity, potentially affecting its interaction with biological systems. The presence of fluorine atoms often enhances metabolic stability and can alter pharmacokinetic properties. Overall, this compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. However, specific physical and chemical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C10H18F3NO
InChI:InChI=1S/C10H18F3NO/c1-14(7-9(15)10(11,12)13)8-5-3-2-4-6-8/h8-9,15H,2-7H2,1H3
InChI key:InChIKey=NKYCUDIAVZBMPB-UHFFFAOYSA-N
SMILES:N(CC(C(F)(F)F)O)(C)C1CCCCC1
Synonyms:
  • 2-Propanol, 3-(cyclohexylmethylamino)-1,1,1-trifluoro-
  • 3-(Cyclohexylmethylamino)-1,1,1-trifluoro-2-propanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.