CymitQuimica logo

CAS 446285-61-6

:

2-ethoxy-5-(tributylstannanyl)-1,3-thiazole

Description:
2-Ethoxy-5-(tributylstannanyl)-1,3-thiazole is an organotin compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The compound features an ethoxy group, which contributes to its solubility and reactivity, and a tributylstannyl group, which is a tin-based moiety known for its applications in organic synthesis and as a stabilizer in various chemical processes. The presence of the tributylstannyl group enhances the compound's ability to participate in nucleophilic substitution reactions, making it useful in the synthesis of more complex organic molecules. Additionally, the thiazole ring can exhibit biological activity, potentially making this compound of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other functional groups. Overall, 2-ethoxy-5-(tributylstannanyl)-1,3-thiazole represents a versatile structure in organometallic chemistry with potential applications in various fields.
Formula:C17H33NOSSn
InChI:InChI=1/C5H6NOS.3C4H9.Sn/c1-2-7-5-6-3-4-8-5;3*1-3-4-2;/h3H,2H2,1H3;3*1,3-4H2,2H3;/rC17H33NOSSn/c1-5-9-12-21(13-10-6-2,14-11-7-3)16-15-18-17(20-16)19-8-4/h15H,5-14H2,1-4H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1cnc(OCC)s1
Synonyms:
  • 2-Ethoxy-5-(tributylstannyl)-1,3-thiazole
  • Thiazole, 2-ethoxy-5-(tributylstannyl)-
  • 2-Ethoxy-5-(Tributylstannyl)Thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.