CAS 4463-33-6
:2,3-Dimethoxytoluene
Description:
2,3-Dimethoxytoluene, with the CAS number 4463-33-6, is an organic compound characterized by its aromatic structure, which includes a toluene backbone substituted with two methoxy groups at the 2 and 3 positions. This compound typically appears as a colorless to pale yellow liquid and is known for its pleasant aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. 2,3-Dimethoxytoluene is often used in organic synthesis and as an intermediate in the production of various chemical compounds. Its properties include moderate volatility and a relatively low boiling point compared to other aromatic compounds. Additionally, it may exhibit reactivity typical of methoxy-substituted aromatics, such as electrophilic substitution reactions. Safety data should be consulted, as with all chemical substances, to understand its handling, storage, and potential hazards.
Formula:C9H12O2
InChI:InChI=1S/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3
InChI key:InChIKey=WMXFNCKPYCAIQW-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(C)=CC=C1
Synonyms:- 1,2-Dimethoxy-3-Methylbenzene
- 3-Methyl-1,2-dimethoxybenzene
- 3-Methylcatechol dimethyl ether
- 3-Methylveratrole
- Benzene, 1,2-dimethoxy-3-methyl-
- NSC 72350
- Toluene, 2,3-dimethoxy-
- o-Homoveratrole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Dimethoxytoluene, 98+%
CAS:2,3-Dimethoxytoluene has been used to prepare 6,7-dimethoxy-4-hydroxyisochroman-3-one. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / iteFormula:C9H12O2Purity:98+%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:152.191,2-DIMETHOXY-3-METHYLBENZENE
CAS:Formula:C9H12O2Purity:98%Color and Shape:LiquidMolecular weight:152.19042,3-Dimethoxytoluene
CAS:2,3-Dimethoxytoluene is a chemical used in food chemistry and analytical methods. It is the product of the reaction between 2-methoxybenzaldehyde and formaldehyde. 2,3-Dimethoxytoluene is used as an intermediate for the synthesis of papaverine, a drug that has analgesic properties. This chemical also reacts with an acid to produce dimethoxytoluene, a chemical that contains two methoxy groups on opposite sides of the benzene ring.
Formula:C9H12O2Purity:Min. 95%Color and Shape:PowderMolecular weight:152.19 g/mol





