CymitQuimica logo

CAS 4464-18-0

:

1,3,5-BENZENETRIMETHANOL

Description:
1,3,5-Benzenetrimethanol, also known as trimethylolbenzene, is an organic compound characterized by its three hydroxymethyl groups (-CH2OH) attached to a benzene ring at the 1, 3, and 5 positions. This structure imparts unique properties, including increased solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of hydroxyl groups. The compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and temperature. It has applications in the production of resins, coatings, and adhesives, owing to its reactivity and ability to enhance the mechanical properties of materials. Additionally, 1,3,5-benzenetrimethanol can serve as a building block in organic synthesis, facilitating the creation of more complex molecules. Safety considerations include handling it with care, as it may cause irritation to the skin and eyes. Overall, its multifunctional nature makes it a valuable compound in various industrial applications.
Formula:C9H12O3
InChI:InChI=1/C9H12O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-3,10-12H,4-6H2
InChI key:SQAMZFDWYRVIMG-UHFFFAOYSA-N
SMILES:c1c(cc(cc1CO)CO)CO
Synonyms:
  • Benzene-1,3,5-triyltrimethanol
  • 1,3,5-Tris(Hydroxymethyl)Benzene
Found 5 products.