CAS 4464-33-9

1,1′-[(1Z,3Z)-2,3-Diisocyano-1,3-butadiene-1,4-diyl]bis[4-methoxybenzene]

Description:

1,1′-[(1Z,3Z)-2,3-Diisocyano-1,3-butadiene-1,4-diyl]bis[4-methoxybenzene], with the CAS number 4464-33-9, is a complex organic compound characterized by its unique structural features. It contains two 4-methoxybenzene groups linked by a 1,3-butadiene moiety that has isocyanide functional groups. This compound exhibits significant reactivity due to the presence of isocyanide groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The methoxy groups contribute to its solubility in organic solvents and may influence its electronic properties, enhancing its potential applications in materials science and organic synthesis. Additionally, the geometric configuration of the butadiene segment, being in the Z (cis) configuration, may affect the compound's physical properties, such as melting point and boiling point. Overall, this compound's unique structure and functional groups make it of interest in the fields of organic chemistry and materials development.

Formula: C₂₀H₁₆N₂O₂

InChI: InChI=1S/C20H16N2O2/c1-21-19(13-15-5-9-17(23-3)10-6-15)20(22-2)14-16-7-11-18(24-4)12-8-16/h5-14H,3-4H3/b19-13-,20-14-

InChI key: InChIKey=VJKZMXOJMQCHRI-AXPXABNXSA-N

SMILES: C(\C(=C\C1=CC=C(OC)C=C1)\[N+]#[C-])(=C/C2=CC=C(OC)C=C2)/[N+]#[C-]

Synonyms:

• Xanthocillin X permethyl ether
• 1,1′-[(1Z,3Z)-2,3-Diisocyano-1,3-butadiene-1,4-diyl]bis[4-methoxybenzene]
• Benzene, 1,1′-[(1Z,3Z)-2,3-diisocyano-1,3-butadiene-1,4-diyl]bis[4-methoxy-
• Xanthocillin dimethyl ether
• Xanthocillin X dimethyl ether

Xanthocillin X permethyl ether

CAS: 4464-33-9

Xanthocillin X permethyl ether, a natural product extracted from fungal sources, exhibits Aβ-42 lowering activity.

Formula: C₂₀H₁₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 316.35

Ref: TM-T13967