CAS 446827-11-8

[2-(ethylsulfanyl)-1,3-thiazol-4-yl]acetic acid

Description:

[2-(ethylsulfanyl)-1,3-thiazol-4-yl]acetic acid is a chemical compound characterized by its thiazole ring, which contains sulfur and nitrogen atoms, contributing to its unique properties. This compound features an ethylsulfanyl group, which enhances its reactivity and solubility in organic solvents. The presence of the acetic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. Its thiazole structure is known for biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular interactions can be influenced by the presence of the ethylsulfanyl group, potentially affecting its biological activity and solubility. As with many thiazole derivatives, it may exhibit antimicrobial or antifungal properties, making it a candidate for further investigation in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₉NO₂S₂

InChI: InChI=1/C7H9NO2S2/c1-2-11-7-8-5(4-12-7)3-6(9)10/h4H,2-3H2,1H3,(H,9,10)

SMILES: CCSc1nc(CC(=O)O)cs1

Synonyms:

• 4-Thiazoleacetic Acid, 2-(Ethylthio)-
• [2-(Ethylsulfanyl)-1,3-thiazol-4-yl]acetic acid

[2-(ethylthio)-1,3-thiazol-4-yl]acetic acid

CAS: 446827-11-8

Formula: C₇H₉NO₂S₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 203.27

Ref: 10-F315486