CAS 446828-80-4

N-(2-Methylbenzoyl)-β-alanine

Description:

N-(2-Methylbenzoyl)-β-alanine is an organic compound characterized by its structure, which includes a β-alanine moiety linked to a 2-methylbenzoyl group. This compound typically exhibits properties associated with both amino acids and aromatic ketones, making it of interest in various chemical applications. It is likely to be a white to off-white solid, soluble in polar organic solvents, and may have moderate stability under standard conditions. The presence of the benzoyl group suggests potential reactivity in electrophilic aromatic substitution reactions, while the β-alanine component may participate in peptide bond formation or other reactions typical of amino acids. Additionally, this compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a building block in pharmaceutical synthesis. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, N-(2-Methylbenzoyl)-β-alanine represents a versatile compound with applications in organic synthesis and potentially in medicinal chemistry.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1S/C11H13NO3/c1-8-4-2-3-5-9(8)11(15)12-7-6-10(13)14/h2-5H,6-7H2,1H3,(H,12,15)(H,13,14)

InChI key: InChIKey=VIRTZKQVLFLGGK-UHFFFAOYSA-N

SMILES: C(NCCC(O)=O)(=O)C1=C(C)C=CC=C1

Synonyms:

• β-Alanine, N-(2-methylbenzoyl)-
• 3-[(2-Methylphenyl)formamido]propanoic acid
• N-(2-Methylbenzoyl)-β-alanine

3-[(2-Methylphenyl)formamido]propanoic acid

CAS: 446828-80-4

Versatile small molecule scaffold

Formula: C₁₁H₁₃NO₃

Purity: Min. 95%

Molecular weight: 207.23 g/mol

Ref: 3D-WSA82880