CAS 446848-52-8

N-{4-[(chloroacetyl)amino]phenyl}-N-methylacetamide

Description:

N-{4-[(Chloroacetyl)amino]phenyl}-N-methylacetamide, with the CAS number 446848-52-8, is a synthetic organic compound characterized by its amide functional groups and a chloroacetyl moiety. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents, reflecting its polar nature due to the presence of amide linkages. It is often utilized in pharmaceutical research and development, particularly in the synthesis of potential therapeutic agents. The presence of the chloroacetyl group suggests reactivity that may facilitate further chemical modifications or interactions with biological targets. Additionally, the compound's structure indicates potential for hydrogen bonding, which can influence its solubility and biological activity. Safety data should be consulted, as the chloroacetyl group can impart toxicity and reactivity. Overall, N-{4-[(chloroacetyl)amino]phenyl}-N-methylacetamide is a compound of interest in medicinal chemistry, with properties that warrant careful handling and investigation.

Formula: C₁₁H₁₃ClN₂O₂

InChI: InChI=1/C11H13ClN2O2/c1-8(15)14(2)10-5-3-9(4-6-10)13-11(16)7-12/h3-6H,7H2,1-2H3,(H,13,16)

SMILES: CC(=O)N(C)c1ccc(cc1)NC(=O)CCl

Synonyms:

• acetamide, N-[4-[(2-chloroacetyl)amino]phenyl]-N-methyl-

N-{4-[acetyl(methyl)amino]phenyl}-2-chloroacetamide

CAS: 446848-52-8

Formula: C₁₁H₁₃ClN₂O₂

Purity: 95.0%

Molecular weight: 240.69

Ref: 10-F315890