CAS 446859-33-2
:2-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)-1,5-naphthyridine
Description:
2-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)-1,5-naphthyridine is a complex organic compound characterized by its multi-ring structure, which includes a naphthyridine moiety and a pyrazole ring substituted with a pyridine group. This compound typically exhibits properties such as moderate to high solubility in organic solvents, depending on the specific functional groups present. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of nitrogen atoms in its structure suggests potential for hydrogen bonding and coordination with metal ions, which can influence its reactivity and interaction with biological targets. Additionally, the methyl group on the pyridine ring can affect the compound's lipophilicity and overall pharmacokinetic properties. As with many heterocyclic compounds, its synthesis may involve multi-step reactions, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of molecules that are valuable in research and development within the fields of chemistry and pharmacology.
Formula:C17H13N5
InChI:InChI=1/C17H13N5/c1-11-4-2-5-16(20-11)17-12(10-19-22-17)13-7-8-14-15(21-13)6-3-9-18-14/h2-10H,1H3,(H,19,22)
SMILES:Cc1cccc(c2c(c[nH]n2)c2ccc3c(cccn3)n2)n1
Synonyms:- 1,5-Naphthyridine, 2-[3-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-
- 1,5-naphthyridine, 2-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-
- 2-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]-1,5-naphthyridine
- Repsox
- 2-[3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl]-1,5-naphthyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
RepSox
CAS:Formula:C17H13N5Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:287.33RepSox
CAS:RepSox (ALK5 Inhibitor II) is a TGFβR-1/ALK5 inhibitor that selectively inhibits the binding of ATP to ALK5 and the autophosphorylation of ALK5 (IC50=23/4 nM).Formula:C17H13N5Purity:98.8% - 99.73%Color and Shape:SolidMolecular weight:287.32Ref: TM-T6337
1mg35.00€2mg48.00€5mg66.00€10mg85.00€25mg123.00€50mg172.00€100mg255.00€500mg630.00€1mL*10mM (DMSO)72.00€RepSox
CAS:<p>Selective inhibitor of the transforming growth factor beta receptor TGFβ1. RepSox can replace Sox, a transcriptional factor required for cell self-renewal, in reprogramming of adult cells to induced pluripotent stem cells (iPSCs). In the cloned interspecies embryos, RepSox induced expression of pluripotency regulatory genes Oct4 and Nanog, improved viability and developmental potential of embryos in the pre-implantation stage.</p>Formula:C17H13N5Purity:Min. 95%Color and Shape:PowderMolecular weight:287.32 g/mol2-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)-1,5-naphthyridine
CAS:Formula:C17H13N5Purity:98%Molecular weight:287.326Alk 5 Inhibitor II
CAS:<p>Applications Alk 5 Inhibitor II is a selective ATP competitive inhibitor of transforming growth factor-β (TGFβ). A potential drug for the treatment of fibrosis and cancer.<br>References Ren, J. et al.: Eur. J. Med. Chem., 44, 4259 (2009)<br></p>Formula:C17H13N5Color and Shape:NeatMolecular weight:287.32






