CAS 447-25-6
:(2S,3R,4S,5S)-6-fluoro-2,3,4,5-tetrahydroxy-hexanal
Description:
The chemical substance known as (2S,3R,4S,5S)-6-fluoro-2,3,4,5-tetrahydroxy-hexanal, with the CAS number 447-25-6, is a carbohydrate derivative characterized by its multiple hydroxyl (-OH) groups and a fluorine atom substituent. This compound features a hexanal backbone, indicating it is an aldehyde with six carbon atoms. The stereochemistry is defined by the specific configuration at four chiral centers, which contributes to its potential biological activity and interaction with enzymes or receptors. The presence of hydroxyl groups suggests that it is likely to be soluble in water and may participate in hydrogen bonding, influencing its reactivity and stability. The fluorine atom can enhance the compound's lipophilicity and alter its metabolic pathways. Such structural features make it of interest in various fields, including medicinal chemistry and biochemistry, where it may serve as a building block for more complex molecules or as a potential therapeutic agent. Understanding its properties is crucial for applications in drug design and synthesis.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-1-3(9)5(11)6(12)4(10)2-8/h2-6,9-12H,1H2/t3-,4-,5-,6+/m1/s1
Synonyms:- 6-deoxy-6-fluoro-glucos
- (3R,4S,5S,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol
- 6-DEOXY-6-FLUORO-D-GALATOSE
- (3R,4S,5S,6S)-6-(fluoromethyl)tetrahydropyran-2,3,4,5-tetrol
- Glucose 6-Fluorohydrin
- 6-Deoxy-6-fluoro-glucopyranose
- 6-DEOXY-6-FLUORO-D-GALACTOSE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Deoxy-6-fluoro-D-galactose
CAS:Controlled ProductApplications 6-Deoxy-6-fluoro-D-galactose (cas# 447-25-6) is a compound useful in organic synthesis.
Formula:C6H11FO5Color and Shape:NeatMolecular weight:182.156-Deoxy-6-fluoro-D-galactose
CAS:6-Deoxy-6-fluoro-D-galactose is a fluorinated sugar that has been shown to inhibit the uptake of glucose by human liver cells. This sugar binds to the enzyme activity and inhibits its activity. 6-Deoxy-6-fluoro-D-galactose was found to be metabolized in a dose dependent manner, with higher doses leading to increased uptake of fluorescein and decreased uptake of glucose. 6FDG is also metabolized by chemical reactions, such as oxidation or hydration, which leads to a decrease in its inhibitory effect on glucose uptake. 6FDG has been shown to bind to sequences that are involved in sugar transport and cell culture studies have shown that this sugar can induce inhibition of cell growth at high concentrations.Formula:C6H11FO5Purity:Min. 95%Color and Shape:PowderMolecular weight:182.15 g/mol



