CAS 4471-51-6
:N-Formylguanidine
Description:
N-Formylguanidine is an organic compound characterized by its guanidine structure with a formyl group attached. It is typically represented by the molecular formula C2H4N4O, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. This compound is known for its role in various chemical reactions, particularly in the synthesis of other nitrogen-containing compounds. N-Formylguanidine is often utilized in the production of energetic materials and can act as a precursor in the formation of more complex molecules. It is a white crystalline solid that is soluble in water and exhibits moderate stability under standard conditions. The compound's reactivity is influenced by the presence of the formyl group, which can participate in further chemical transformations. Safety considerations should be taken into account when handling N-Formylguanidine, as it may pose health risks if ingested or inhaled. Overall, its unique structure and reactivity make it a compound of interest in both academic and industrial chemistry.
Formula:C2H5N3O
InChI:InChI=1S/C2H5N3O/c3-2(4)5-1-6/h1H,(H4,3,4,5,6)
InChI key:InChIKey=XEBPBJPZBUSUEO-UHFFFAOYSA-N
SMILES:N(C(=N)N)C=O
Synonyms:- 1-Formyl-3-cyanoguanidine
- 2-Formylguanidine
- Formamide, N-(aminoiminomethyl)-
- Formamide, N-amidino-
- Formylguanidine
- Guanidine, N-formyl-
- Guanidine, formyl-
- N-Formylguanidine
- NSC 77929
- N-(Aminoiminomethyl)formamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-Formylguanidine
CAS:Controlled ProductFormula:C2H5N3OColor and Shape:Off-WhiteMolecular weight:87.081
