CAS 4474-91-3: angiotensin II
Description:Angiotensin II is a potent peptide hormone that plays a crucial role in the regulation of blood pressure and fluid balance in the body. It is an octapeptide, composed of eight amino acids, and is derived from angiotensin I through the action of the enzyme angiotensin-converting enzyme (ACE). Angiotensin II primarily functions by constricting blood vessels, which increases vascular resistance and, consequently, blood pressure. Additionally, it stimulates the release of aldosterone from the adrenal glands, promoting sodium and water retention by the kidneys, further contributing to increased blood volume and pressure. The substance is also involved in stimulating thirst and the release of antidiuretic hormone (ADH), enhancing its effects on fluid retention. Angiotensin II acts on specific receptors, primarily the AT1 receptor, which mediates its physiological effects. Due to its significant role in cardiovascular health, angiotensin II and its pathways are often targeted in the treatment of hypertension and heart failure, making it a critical focus in pharmacological research.
Formula:C50H71N13O12
InChI:InChI=1/C50H71N13O12/c1-5-28(4)41(47(72)59-36(23-31-25-54-26-56-31)48(73)63-20-10-14-38(63)45(70)60-37(49(74)75)22-29-11-7-6-8-12-29)62-44(69)35(21-30-15-17-32(64)18-16-30)58-46(71)40(27(2)3)61-43(68)34(13-9-19-55-50(52)53)57-42(67)33(51)24-39(65)66/h6-8,11-12,15-18,25-28,33-38,40-41,64H,5,9-10,13-14,19-24,51H2,1-4H3,(H,54,56)(H,57,67)(H,58,71)(H,59,72)(H,60,70)(H,61,68)(H,62,69)(H,65,66)(H,74,75)(H4,52,53,55)/t28-,33-,34-,35-,36-,37-,38-,40-,41-/m0/s1
- Synonyms:
- Angiotensin Ii, Human
- Angiotensin II
- Angiotensin II acetate salt