CAS 447463-56-1

1-(bromomethyl)-2-fluoro-3-methoxy-benzene

Description:

1-(Bromomethyl)-2-fluoro-3-methoxy-benzene, with the CAS number 447463-56-1, is an organic compound characterized by the presence of a bromomethyl group, a fluorine atom, and a methoxy group attached to a benzene ring. This compound features a bromine atom, which typically enhances reactivity, particularly in nucleophilic substitution reactions. The fluorine atom introduces electronegativity, influencing the compound's polarity and potential interactions with other molecules. The methoxy group (-OCH3) is an electron-donating substituent that can affect the compound's reactivity and solubility in various solvents. The overall structure suggests that it may exhibit interesting properties, such as potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of multiple functional groups may lead to diverse chemical behavior, including variations in reactivity under different conditions. Safety and handling precautions should be observed due to the presence of bromine and fluorine, which can pose health risks.

Formula: C₈H₈BrFO

InChI: InChI=1/C8H8BrFO/c1-11-7-4-2-3-6(5-9)8(7)10/h2-4H,5H2,1H3

SMILES: COc1cccc(CBr)c1F

Synonyms:

• 1-(Bromomethyl)-2-fluoro-3-methoxybenzene
• 3-(Bromomethyl)-2-fluorophenyl methyl ether
• Benzene, 1-(Bromomethyl)-2-Fluoro-3-Methoxy-
• 2-Fluoro-3-methoxybenzylbromide

2-Fluoro-3-methoxybenzylbromide

CAS: 447463-56-1

Formula: C₈H₈BrFO

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.0509

Ref: IN-DA00D8Y9

2-Fluoro-3-methoxybenzyl bromide

CAS: 447463-56-1

2-Fluoro-3-methoxybenzyl bromide

Formula: C₈H₈BrFO

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 219.05g/mol

Ref: 54-PC7985

2-Fluoro-3-methoxybenzyl bromide

CAS: 447463-56-1

Formula: C₈H₈BrFO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 219.053

Ref: 10-F067824